C19H16F6N2O2 — CID 11847398
[3-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]diazenyl]propyl] acetate (PubChem CID 11847398) has the molecular formula C19H16F6N2O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]diazenyl]propyl] acetate.
| Compound Name | [3-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]diazenyl]propyl] acetate |
|---|---|
| PubChem CID | 11847398 |
| Molecular Formula | C19H16F6N2O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]-2-[[4-(trifluoromethyl)phenyl]diazenyl]propyl] acetate |
| SMILES | CC(=O)OCC(Cc1ccc(C(F)(F)F)cc1)/N=N/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F6N2O2/c1-12(28)29-11-17(10-13-2-4-14(5-3-13)18(20,21)22)27-26-16-8-6-15(7-9-16)19(23,24)25/h2-9,17H,10-11H2,1H3/b27-26+ |
| InChIKey | PEZVRNLRXHZMKP-CYYJNZCTSA-N |
| XLogP | 5.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|