C18H16F2N2O2 — CID 102600307
(4,15-difluoro-10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,13,15-heptaen-10-yl)methyl acetate (PubChem CID 102600307) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is (4,15-difluoro-10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,13,15-heptaen-10-yl)methyl acetate.
| Compound Name | (4,15-difluoro-10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,13,15-heptaen-10-yl)methyl acetate |
|---|---|
| PubChem CID | 102600307 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (4,15-difluoro-10-methyl-8,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,13,15-heptaen-10-yl)methyl acetate |
| SMILES | CC(=O)OCC1(C)Cc2ccc(F)cc2-c2cc(F)ccc2/N=N\1 |
| InChI | InChI=1S/C18H16F2N2O2/c1-11(23)24-10-18(2)9-12-3-4-13(19)7-15(12)16-8-14(20)5-6-17(16)21-22-18/h3-8H,9-10H2,1-2H3/b22-21- |
| InChIKey | YZJFIGMBUQOXQB-DQRAZIAOSA-N |
| XLogP | 4.59 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |