C23H26F3NO2 — CID 101128336
6-[4-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl]hexyl propanoate (PubChem CID 101128336) has the molecular formula C23H26F3NO2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 6-[4-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl]hexyl propanoate.
| Compound Name | 6-[4-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl]hexyl propanoate |
|---|---|
| PubChem CID | 101128336 |
| Molecular Formula | C23H26F3NO2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 6-[4-[[4-(trifluoromethyl)phenyl]iminomethyl]phenyl]hexyl propanoate |
| SMILES | CCC(=O)OCCCCCCc1ccc(/C=N/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H26F3NO2/c1-2-22(28)29-16-6-4-3-5-7-18-8-10-19(11-9-18)17-27-21-14-12-20(13-15-21)23(24,25)26/h8-15,17H,2-7,16H2,1H3/b27-17+ |
| InChIKey | LARSYWRMJVRZDC-WPWMEQJKSA-N |
| XLogP | 6.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|