C25H34BrN7O3 — CID 118475366
2-[2-[4-[[6-bromo-4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-2-yl]amino]pyrazol-1-yl]ethoxy]ethanol (PubChem CID 118475366) has the molecular formula C25H34BrN7O3 and a molecular weight of 560.50 g/mol. Its IUPAC name is 2-[2-[4-[[6-bromo-4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-2-yl]amino]pyrazol-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[[6-bromo-4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-2-yl]amino]pyrazol-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 118475366 |
| Molecular Formula | C25H34BrN7O3 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[2-[4-[[6-bromo-4-[(4-morpholin-4-ylcyclohexyl)amino]quinazolin-2-yl]amino]pyrazol-1-yl]ethoxy]ethanol |
| SMILES | OCCOCCn1cc(Nc2nc(NC3CCC(N4CCOCC4)CC3)c3cc(Br)ccc3n2)cn1 |
| InChI | InChI=1S/C25H34BrN7O3/c26-18-1-6-23-22(15-18)24(28-19-2-4-21(5-3-19)32-7-11-35-12-8-32)31-25(30-23)29-20-16-27-33(17-20)9-13-36-14-10-34/h1,6,15-17,19,21,34H,2-5,7-14H2,(H2,28,29,30,31) |
| InChIKey | SKRUDNHVOPYJPS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|