C26H37N7O3S — CID 90287236
2-[2-[4-[[12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]amino]pyrazol-1-yl]ethoxy]ethanol (PubChem CID 90287236) has the molecular formula C26H37N7O3S and a molecular weight of 527.70 g/mol. Its IUPAC name is 2-[2-[4-[[12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]amino]pyrazol-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[[12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]amino]pyrazol-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 90287236 |
| Molecular Formula | C26H37N7O3S |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 2-[2-[4-[[12-[(4-morpholin-4-ylcyclohexyl)amino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-yl]amino]pyrazol-1-yl]ethoxy]ethanol |
| SMILES | OCCOCCn1cc(Nc2nc(NC3CCC(N4CCOCC4)CC3)c3c4c(sc3n2)CCC4)cn1 |
| InChI | InChI=1S/C26H37N7O3S/c34-11-15-36-14-10-33-17-19(16-27-33)29-26-30-24(23-21-2-1-3-22(21)37-25(23)31-26)28-18-4-6-20(7-5-18)32-8-12-35-13-9-32/h16-18,20,34H,1-15H2,(H2,28,29,30,31) |
| InChIKey | RCKNQVPSTCABJV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|