C22H29N7OS — CID 90287206
12-N-(4-morpholin-4-ylcyclohexyl)-10-N-(1H-pyrazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-10,12-diamine (PubChem CID 90287206) has the molecular formula C22H29N7OS and a molecular weight of 439.59 g/mol. Its IUPAC name is 12-N-(4-morpholin-4-ylcyclohexyl)-10-N-(1H-pyrazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-10,12-diamine.
| Compound Name | 12-N-(4-morpholin-4-ylcyclohexyl)-10-N-(1H-pyrazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-10,12-diamine |
|---|---|
| PubChem CID | 90287206 |
| Molecular Formula | C22H29N7OS |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 12-N-(4-morpholin-4-ylcyclohexyl)-10-N-(1H-pyrazol-4-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-10,12-diamine |
| SMILES | c1n[nH]cc1Nc1nc(NC2CCC(N3CCOCC3)CC2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C22H29N7OS/c1-2-17-18(3-1)31-21-19(17)20(27-22(28-21)26-15-12-23-24-13-15)25-14-4-6-16(7-5-14)29-8-10-30-11-9-29/h12-14,16H,1-11H2,(H,23,24)(H2,25,26,27,28) |
| InChIKey | PHZOGYDLTYYSSC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |