C25H30N4O2S — CID 86344702
12-(4-morpholin-4-ylcyclohexyl)oxy-N-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine (PubChem CID 86344702) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 12-(4-morpholin-4-ylcyclohexyl)oxy-N-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine.
| Compound Name | 12-(4-morpholin-4-ylcyclohexyl)oxy-N-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine |
|---|---|
| PubChem CID | 86344702 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 12-(4-morpholin-4-ylcyclohexyl)oxy-N-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine |
| SMILES | c1ccc(Nc2nc(OC3CCC(N4CCOCC4)CC3)c3c4c(sc3n2)CCC4)cc1 |
| InChI | InChI=1S/C25H30N4O2S/c1-2-5-17(6-3-1)26-25-27-23(22-20-7-4-8-21(20)32-24(22)28-25)31-19-11-9-18(10-12-19)29-13-15-30-16-14-29/h1-3,5-6,18-19H,4,7-16H2,(H,26,27,28) |
| InChIKey | ARGAWZIXXIAVFD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |