C28H38N6OS — CID 90271802
12-[4-(dimethylamino)cyclohexyl]oxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine (PubChem CID 90271802) has the molecular formula C28H38N6OS and a molecular weight of 506.72 g/mol. Its IUPAC name is 12-[4-(dimethylamino)cyclohexyl]oxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine.
| Compound Name | 12-[4-(dimethylamino)cyclohexyl]oxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine |
|---|---|
| PubChem CID | 90271802 |
| Molecular Formula | C28H38N6OS |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 12-[4-(dimethylamino)cyclohexyl]oxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-10-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(OC4CCC(N(C)C)CC4)c4c5c(sc4n3)CCC5)cc2)CC1 |
| InChI | InChI=1S/C28H38N6OS/c1-32(2)20-11-13-22(14-12-20)35-26-25-23-5-4-6-24(23)36-27(25)31-28(30-26)29-19-7-9-21(10-8-19)34-17-15-33(3)16-18-34/h7-10,20,22H,4-6,11-18H2,1-3H3,(H,29,30,31) |
| InChIKey | ZUGIVWCXKHOFQY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|