C17H25N5O3S2 — CID 71665930
3-[4-(dimethylamino)cyclohexyl]oxy-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-sulfonamide (PubChem CID 71665930) has the molecular formula C17H25N5O3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-[4-(dimethylamino)cyclohexyl]oxy-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-sulfonamide.
| Compound Name | 3-[4-(dimethylamino)cyclohexyl]oxy-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-sulfonamide |
|---|---|
| PubChem CID | 71665930 |
| Molecular Formula | C17H25N5O3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-[4-(dimethylamino)cyclohexyl]oxy-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-sulfonamide |
| SMILES | CN(C)C1CCC(Oc2ncnc3sc4c(c23)CN(S(N)(=O)=O)CC4)CC1 |
| InChI | InChI=1S/C17H25N5O3S2/c1-21(2)11-3-5-12(6-4-11)25-16-15-13-9-22(27(18,23)24)8-7-14(13)26-17(15)20-10-19-16/h10-12H,3-9H2,1-2H3,(H2,18,23,24) |
| InChIKey | NYJOTBXMWAVXCO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |