About [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate
[4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate (PubChem CID 73053423) has the molecular formula C21H26N4O3S
and a molecular weight of 414.53 g/mol. Its IUPAC name is [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate |
| PubChem CID | 73053423 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2sc3ncnc(OC4CCC(N(C)C)CC4)c3c2c1 |
| InChI | InChI=1S/C21H26N4O3S/c1-24(2)13-5-7-14(8-6-13)27-19-18-16-11-15(28-21(26)25(3)4)9-10-17(16)29-20(18)23-12-22-19/h9-14H,5-8H2,1-4H3 |
| InChIKey | OEGHJFLVOSXFKE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate?
The IUPAC name of [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate (CID 73053423) is [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate?
The canonical SMILES for [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate is CN(C)C(=O)Oc1ccc2sc3ncnc(OC4CCC(N(C)C)CC4)c3c2c1.
What is the InChIKey of [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate?
The InChIKey is OEGHJFLVOSXFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3S/c1-24(2)13-5-7-14(8-6-13)27-19-18-16-11-15(28-21(26)25(3)4)9-10-17(16)29-20(18)23-12-22-19/h9-14H,5-8H2,1-4H3.
What are the key properties of [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate?
[4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate has a molecular weight of 414.53 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(dimethylamino)cyclohexyl]oxy-[1]benzothiolo[2,3-d]pyrimidin-6-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 73053423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).