C21H32N4O3S2 — CID 147902789
4-[(12-butylsulfonyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)oxy]-N,N-dimethylcyclohexan-1-amine (PubChem CID 147902789) has the molecular formula C21H32N4O3S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 4-[(12-butylsulfonyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)oxy]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 4-[(12-butylsulfonyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)oxy]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 147902789 |
| Molecular Formula | C21H32N4O3S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 4-[(12-butylsulfonyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)oxy]-N,N-dimethylcyclohexan-1-amine |
| SMILES | CCCCS(=O)(=O)N1CCc2sc3ncnc(OC4CCC(N(C)C)CC4)c3c2C1 |
| InChI | InChI=1S/C21H32N4O3S2/c1-4-5-12-30(26,27)25-11-10-18-17(13-25)19-20(22-14-23-21(19)29-18)28-16-8-6-15(7-9-16)24(2)3/h14-16H,4-13H2,1-3H3 |
| InChIKey | IEPFGPAAUQRYBD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |