C19H27N5O2S — CID 86695245
3-[4-(dimethylamino)cyclohexyl]oxy-N-methyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-carboxamide (PubChem CID 86695245) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 3-[4-(dimethylamino)cyclohexyl]oxy-N-methyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-carboxamide.
| Compound Name | 3-[4-(dimethylamino)cyclohexyl]oxy-N-methyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 86695245 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 3-[4-(dimethylamino)cyclohexyl]oxy-N-methyl-8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-12-carboxamide |
| SMILES | CNC(=O)N1CCc2sc3ncnc(OC4CCC(N(C)C)CC4)c3c2C1 |
| InChI | InChI=1S/C19H27N5O2S/c1-20-19(25)24-9-8-15-14(10-24)16-17(21-11-22-18(16)27-15)26-13-6-4-12(5-7-13)23(2)3/h11-13H,4-10H2,1-3H3,(H,20,25) |
| InChIKey | YKWLPWYNKKDMLK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |