C19H26N4O2S — CID 86695248
4-[4-(8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yloxy)cyclohexyl]morpholine (PubChem CID 86695248) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-[4-(8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yloxy)cyclohexyl]morpholine.
| Compound Name | 4-[4-(8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yloxy)cyclohexyl]morpholine |
|---|---|
| PubChem CID | 86695248 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[4-(8-thia-4,6,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yloxy)cyclohexyl]morpholine |
| SMILES | c1nc(OC2CCC(N3CCOCC3)CC2)c2c3c(sc2n1)CCNC3 |
| InChI | InChI=1S/C19H26N4O2S/c1-3-14(4-2-13(1)23-7-9-24-10-8-23)25-18-17-15-11-20-6-5-16(15)26-19(17)22-12-21-18/h12-14,20H,1-11H2 |
| InChIKey | XDGCMNJSFZQEQJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |