C23H30N6O2S — CID 118916529
4-N-(4-morpholin-4-ylcyclohexyl)-4-N-(1,3-oxazol-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 118916529) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 4-N-(4-morpholin-4-ylcyclohexyl)-4-N-(1,3-oxazol-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-morpholin-4-ylcyclohexyl)-4-N-(1,3-oxazol-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118916529 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-N-(4-morpholin-4-ylcyclohexyl)-4-N-(1,3-oxazol-2-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N(c2ncco2)C2CCC(N3CCOCC3)CC2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C23H30N6O2S/c24-22-26-20(19-17-3-1-2-4-18(17)32-21(19)27-22)29(23-25-9-12-31-23)16-7-5-15(6-8-16)28-10-13-30-14-11-28/h9,12,15-16H,1-8,10-11,13-14H2,(H2,24,26,27) |
| InChIKey | UCJOGFVADYNTHN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |