C25H27Cl2N7O — CID 118475759
N-[3-[[[5-chloro-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 118475759) has the molecular formula C25H27Cl2N7O and a molecular weight of 512.45 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118475759 |
| Molecular Formula | C25H27Cl2N7O |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-[3-[[[5-chloro-2-[3-chloro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3ccc(N4CCN(C)CC4)c(Cl)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C25H27Cl2N7O/c1-3-23(35)30-18-6-4-5-17(13-18)15-28-24-21(27)16-29-25(32-24)31-19-7-8-22(20(26)14-19)34-11-9-33(2)10-12-34/h3-8,13-14,16H,1,9-12,15H2,2H3,(H,30,35)(H2,28,29,31,32) |
| InChIKey | YFTFCIRIRKKHTO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|