C19H20N2O5S — CID 11848285
N-hydroxy-6-(6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)hexanamide (PubChem CID 11848285) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-hydroxy-6-(6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)hexanamide.
| Compound Name | N-hydroxy-6-(6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)hexanamide |
|---|---|
| PubChem CID | 11848285 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-hydroxy-6-(6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2S(=O)(=O)c2ccccc21)NO |
| InChI | InChI=1S/C19H20N2O5S/c22-18(20-24)12-2-1-7-13-21-15-9-4-6-11-17(15)27(25,26)16-10-5-3-8-14(16)19(21)23/h3-6,8-11,24H,1-2,7,12-13H2,(H,20,22) |
| InChIKey | RJAYGVNEJDTCPZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|