C19H19ClN2O5S — CID 11848286
6-(3-chloro-6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide (PubChem CID 11848286) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is 6-(3-chloro-6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide.
| Compound Name | 6-(3-chloro-6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 11848286 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 6-(3-chloro-6,11,11-trioxobenzo[b][1,4]benzothiazepin-5-yl)-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2S(=O)(=O)c2ccc(Cl)cc21)NO |
| InChI | InChI=1S/C19H19ClN2O5S/c20-13-9-10-17-15(12-13)22(11-5-1-2-8-18(23)21-25)19(24)14-6-3-4-7-16(14)28(17,26)27/h3-4,6-7,9-10,12,25H,1-2,5,8,11H2,(H,21,23) |
| InChIKey | NFHXGOMHHHZQGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|