C24H24FN5O2 — CID 118483145
US10023543, Example 30 (PubChem CID 118483145) has the molecular formula C24H24FN5O2 and a molecular weight of 433.50 g/mol. Its IUPAC name is 4-[2-[(3R)-3-aminopiperidin-1-yl]-5-(4-methoxyphenyl)-1-methyl-6-oxopyrimidin-4-yl]-2-fluorobenzonitrile.
| Compound Name | US10023543, Example 30 |
|---|---|
| PubChem CID | 118483145 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-[2-[(3R)-3-aminopiperidin-1-yl]-5-(4-methoxyphenyl)-1-methyl-6-oxopyrimidin-4-yl]-2-fluorobenzonitrile |
| SMILES | CN1C(=O)C(=C(N=C1N2CCC[C@H](C2)N)C3=CC(=C(C=C3)C#N)F)C4=CC=C(C=C4)OC |
| InChI | InChI=1S/C24H24FN5O2/c1-29-23(31)21(15-7-9-19(32-2)10-8-15)22(16-5-6-17(13-26)20(25)12-16)28-24(29)30-11-3-4-18(27)14-30/h5-10,12,18H,3-4,11,14,27H2,1-2H3/t18-/m1/s1 |
| InChIKey | YEMSSUBRSBUHIG-GOSISDBHSA-N |
| XLogP | 2.10 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | 825 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |