C21H15ClN4OS — CID 118485525
11-benzyl-8-[(3-chlorophenyl)methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 118485525) has the molecular formula C21H15ClN4OS and a molecular weight of 406.90 g/mol. Its IUPAC name is 11-benzyl-8-[(3-chlorophenyl)methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 11-benzyl-8-[(3-chlorophenyl)methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 118485525 |
| Molecular Formula | C21H15ClN4OS |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 11-benzyl-8-[(3-chlorophenyl)methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | O=c1n(Cc2cccc(Cl)c2)c2sc(Cc3ccccc3)cc2c2ncnn12 |
| InChI | InChI=1S/C21H15ClN4OS/c22-16-8-4-7-15(9-16)12-25-20-18(19-23-13-24-26(19)21(25)27)11-17(28-20)10-14-5-2-1-3-6-14/h1-9,11,13H,10,12H2 |
| InChIKey | WIUKRYCFMGWGIT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |