C29H21Cl2N3O2 — CID 3188187
N-[2-benzyl-3-[(3-chlorophenyl)methyl]-4-oxoquinazolin-6-yl]-4-chlorobenzamide (PubChem CID 3188187) has the molecular formula C29H21Cl2N3O2 and a molecular weight of 514.41 g/mol. Its IUPAC name is N-[2-benzyl-3-[(3-chlorophenyl)methyl]-4-oxoquinazolin-6-yl]-4-chlorobenzamide.
| Compound Name | N-[2-benzyl-3-[(3-chlorophenyl)methyl]-4-oxoquinazolin-6-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 3188187 |
| Molecular Formula | C29H21Cl2N3O2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | N-[2-benzyl-3-[(3-chlorophenyl)methyl]-4-oxoquinazolin-6-yl]-4-chlorobenzamide |
| SMILES | O=C(Nc1ccc2nc(Cc3ccccc3)n(Cc3cccc(Cl)c3)c(=O)c2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H21Cl2N3O2/c30-22-11-9-21(10-12-22)28(35)32-24-13-14-26-25(17-24)29(36)34(18-20-7-4-8-23(31)15-20)27(33-26)16-19-5-2-1-3-6-19/h1-15,17H,16,18H2,(H,32,35) |
| InChIKey | PXSHSQNYJWHRGL-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |