C22H22ClN3O4 — CID 3197719
ethyl 4-[[3-[(3-chlorophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]amino]-4-oxobutanoate (PubChem CID 3197719) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is ethyl 4-[[3-[(3-chlorophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[3-[(3-chlorophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3197719 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | ethyl 4-[[3-[(3-chlorophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc2nc(C)n(Cc3cccc(Cl)c3)c(=O)c2c1 |
| InChI | InChI=1S/C22H22ClN3O4/c1-3-30-21(28)10-9-20(27)25-17-7-8-19-18(12-17)22(29)26(14(2)24-19)13-15-5-4-6-16(23)11-15/h4-8,11-12H,3,9-10,13H2,1-2H3,(H,25,27) |
| InChIKey | SKEIJSVSTWPABQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |