C21H21N3O6P+ — CID 118486163
[(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methoxy-butoxy-oxophosphanium (PubChem CID 118486163) has the molecular formula C21H21N3O6P+ and a molecular weight of 442.39 g/mol. Its IUPAC name is [(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methoxy-butoxy-oxophosphanium.
| Compound Name | [(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methoxy-butoxy-oxophosphanium |
|---|---|
| PubChem CID | 118486163 |
| Molecular Formula | C21H21N3O6P+ |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [(3R,3aS)-7-(6-cyano-3-pyridinyl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methoxy-butoxy-oxophosphanium |
| SMILES | CCCCO[P+](=O)OC[C@@H]1OC(=O)N2c3ccc(-c4ccc(C#N)nc4)cc3OC[C@@H]12 |
| InChI | InChI=1S/C21H21N3O6P/c1-2-3-8-28-31(26)29-13-20-18-12-27-19-9-14(15-4-6-16(10-22)23-11-15)5-7-17(19)24(18)21(25)30-20/h4-7,9,11,18,20H,2-3,8,12-13H2,1H3/q+1/t18-,20-/m0/s1 |
| InChIKey | FRCMRVHOUPOJBC-ICSRJNTNSA-N |
| XLogP | 4.20 |
| TPSA | 110.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|