C15H32O8 — CID 118488809
2-[2-(hydroperoxymethyl)-2-(1-hydroxypropan-2-yloxymethyl)-3-(1-methoxypropan-2-yloxy)propoxy]propan-1-ol (PubChem CID 118488809) has the molecular formula C15H32O8 and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[2-(hydroperoxymethyl)-2-(1-hydroxypropan-2-yloxymethyl)-3-(1-methoxypropan-2-yloxy)propoxy]propan-1-ol.
| Compound Name | 2-[2-(hydroperoxymethyl)-2-(1-hydroxypropan-2-yloxymethyl)-3-(1-methoxypropan-2-yloxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 118488809 |
| Molecular Formula | C15H32O8 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-[2-(hydroperoxymethyl)-2-(1-hydroxypropan-2-yloxymethyl)-3-(1-methoxypropan-2-yloxy)propoxy]propan-1-ol |
| SMILES | COCC(C)OCC(COO)(COC(C)CO)COC(C)CO |
| InChI | InChI=1S/C15H32O8/c1-12(5-16)20-8-15(11-23-18,9-21-13(2)6-17)10-22-14(3)7-19-4/h12-14,16-18H,5-11H2,1-4H3 |
| InChIKey | NLDIECVEJWGEPI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|