C18H22N2OS — CID 118489532
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-hydroxypiperazine (PubChem CID 118489532) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-hydroxypiperazine.
| Compound Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-hydroxypiperazine |
|---|---|
| PubChem CID | 118489532 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-hydroxypiperazine |
| SMILES | Cc1ccc(Sc2ccccc2N2CCN(O)CC2)c(C)c1 |
| InChI | InChI=1S/C18H22N2OS/c1-14-7-8-17(15(2)13-14)22-18-6-4-3-5-16(18)19-9-11-20(21)12-10-19/h3-8,13,21H,9-12H2,1-2H3 |
| InChIKey | SFZVSIQLKIWKAK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |