C18H23ClN2S — CID 66860907
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrochloride (PubChem CID 66860907) has the molecular formula C18H23ClN2S and a molecular weight of 334.92 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrochloride.
| Compound Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 66860907 |
| Molecular Formula | C18H23ClN2S |
| Molecular Weight | 334.92 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrochloride |
| SMILES | Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.Cl |
| InChI | InChI=1S/C18H22N2S.ClH/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;/h3-8,13,19H,9-12H2,1-2H3;1H |
| InChIKey | JOJYHYRCIYAVHN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |