About 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole
1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole (PubChem CID 118491671) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole.
Analyze 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole?
The IUPAC name of 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole (CID 118491671) is 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole.
What is the SMILES notation for 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole?
The canonical SMILES for 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole is Cc1nn(C)c2c1CN(C)C2.
What is the InChIKey of 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole?
The InChIKey is JULJOILKCDADNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-7-4-10(2)5-8(7)11(3)9-6/h4-5H2,1-3H3.
What are the key properties of 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole?
1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole has a molecular weight of 151.21 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trimethyl-4,6-dihydropyrrolo[3,4-d]pyrazole is sourced from PubChem (CID 118491671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).