About 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine
1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine (PubChem CID 75465061) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine.
Analyze 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine?
The IUPAC name of 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine (CID 75465061) is 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine.
What is the SMILES notation for 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine?
The canonical SMILES for 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine is Cc1nn(C)c2c1CCNC2.
What is the InChIKey of 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine?
The InChIKey is HNBHVZUDKSBQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-7-3-4-9-5-8(7)11(2)10-6/h9H,3-5H2,1-2H3.
What are the key properties of 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine?
1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine has a molecular weight of 151.21 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridine is sourced from PubChem (CID 75465061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).