C11H15N5 — CID 96610505
3,5-dimethyl-6,7,8,9-tetrahydropyrazolo[3,4-c][2,6]naphthyridin-1-amine (PubChem CID 96610505) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3,5-dimethyl-6,7,8,9-tetrahydropyrazolo[3,4-c][2,6]naphthyridin-1-amine.
| Compound Name | 3,5-dimethyl-6,7,8,9-tetrahydropyrazolo[3,4-c][2,6]naphthyridin-1-amine |
|---|---|
| PubChem CID | 96610505 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3,5-dimethyl-6,7,8,9-tetrahydropyrazolo[3,4-c][2,6]naphthyridin-1-amine |
| SMILES | Cc1nc2c(c(N)nn2C)c2c1CCNC2 |
| InChI | InChI=1S/C11H15N5/c1-6-7-3-4-13-5-8(7)9-10(12)15-16(2)11(9)14-6/h13H,3-5H2,1-2H3,(H2,12,15) |
| InChIKey | LFSQHMADHWAKFS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |