C11H11BrFNO3 — CID 118494452
ethyl 2-[4-bromo-2-(fluoromethyl)anilino]-2-oxoacetate (PubChem CID 118494452) has the molecular formula C11H11BrFNO3 and a molecular weight of 304.12 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-(fluoromethyl)anilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-bromo-2-(fluoromethyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 118494452 |
| Molecular Formula | C11H11BrFNO3 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | ethyl 2-[4-bromo-2-(fluoromethyl)anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc(Br)cc1CF |
| InChI | InChI=1S/C11H11BrFNO3/c1-2-17-11(16)10(15)14-9-4-3-8(12)5-7(9)6-13/h3-5H,2,6H2,1H3,(H,14,15) |
| InChIKey | ZVDIDIVLJLHCSM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|