C23H22N2O4 — CID 11849537
methyl (Z)-6-(4-cyanophenyl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate (PubChem CID 11849537) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl (Z)-6-(4-cyanophenyl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate.
| Compound Name | methyl (Z)-6-(4-cyanophenyl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate |
|---|---|
| PubChem CID | 11849537 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | methyl (Z)-6-(4-cyanophenyl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate |
| SMILES | COC(=O)CCC/C=C(/c1ccc(C#N)cc1)c1cc(C)c2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C23H22N2O4/c1-15-12-18(13-20-22(15)29-23(27)25(20)2)19(6-4-5-7-21(26)28-3)17-10-8-16(14-24)9-11-17/h6,8-13H,4-5,7H2,1-3H3/b19-6- |
| InChIKey | AXMOPORLSRSZQK-SWNXQHNESA-N |
| XLogP | 4.09 |
| TPSA | 85.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|