C25H27F3N8S — CID 118497370
5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 118497370) has the molecular formula C25H27F3N8S and a molecular weight of 528.61 g/mol. Its IUPAC name is 5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 118497370 |
| Molecular Formula | C25H27F3N8S |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)CN1CCC(n2cc(-c3cnc4ccc(Nc5nnc(C6CCCC6)s5)nc4c3)cn2)CC1 |
| InChI | InChI=1S/C25H27F3N8S/c26-25(27,28)15-35-9-7-19(8-10-35)36-14-18(13-30-36)17-11-21-20(29-12-17)5-6-22(31-21)32-24-34-33-23(37-24)16-3-1-2-4-16/h5-6,11-14,16,19H,1-4,7-10,15H2,(H,31,32,34) |
| InChIKey | XIEVVEMZTDHOBU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |