C21H24F3N7S — CID 118507180
5-cyclopentyl-N-[7-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 118507180) has the molecular formula C21H24F3N7S and a molecular weight of 463.53 g/mol. Its IUPAC name is 5-cyclopentyl-N-[7-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopentyl-N-[7-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 118507180 |
| Molecular Formula | C21H24F3N7S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 5-cyclopentyl-N-[7-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)CN1CCN(c2cnc3ccc(Nc4nnc(C5CCCC5)s4)nc3c2)CC1 |
| InChI | InChI=1S/C21H24F3N7S/c22-21(23,24)13-30-7-9-31(10-8-30)15-11-17-16(25-12-15)5-6-18(26-17)27-20-29-28-19(32-20)14-3-1-2-4-14/h5-6,11-12,14H,1-4,7-10,13H2,(H,26,27,29) |
| InChIKey | DVGMCVQCOUORSZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |