C19H18FN5 — CID 118498054
3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]pyridazin-3-yl]pyridin-2-amine (PubChem CID 118498054) has the molecular formula C19H18FN5 and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]pyridazin-3-yl]pyridin-2-amine.
| Compound Name | 3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]pyridazin-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 118498054 |
| Molecular Formula | C19H18FN5 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[6-[[1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]pyridazin-3-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1ccc(CC2(c3ncccc3F)CCC2)nn1 |
| InChI | InChI=1S/C19H18FN5/c20-15-5-2-10-22-17(15)19(8-3-9-19)12-13-6-7-16(25-24-13)14-4-1-11-23-18(14)21/h1-2,4-7,10-11H,3,8-9,12H2,(H2,21,23) |
| InChIKey | RELUMUGCSRGWDO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |