C29H29FN2O3 — CID 118498233
methyl 2-[4-cyano-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methyl]phenyl]pyrrolidin-2-yl]acetate (PubChem CID 118498233) has the molecular formula C29H29FN2O3 and a molecular weight of 472.56 g/mol. Its IUPAC name is methyl 2-[4-cyano-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methyl]phenyl]pyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[4-cyano-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methyl]phenyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 118498233 |
| Molecular Formula | C29H29FN2O3 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | methyl 2-[4-cyano-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methyl]phenyl]pyrrolidin-2-yl]acetate |
| SMILES | COC(=O)CC1CC(C#N)CN1c1ccc(Cc2ccc(-c3cc(OC)ccc3F)cc2C)cc1 |
| InChI | InChI=1S/C29H29FN2O3/c1-19-12-23(27-16-26(34-2)10-11-28(27)30)7-6-22(19)13-20-4-8-24(9-5-20)32-18-21(17-31)14-25(32)15-29(33)35-3/h4-12,16,21,25H,13-15,18H2,1-3H3 |
| InChIKey | JHIGYQAQEGYVOL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|