C34H34FNO4 — CID 126689083
methyl 2-[(2R,4S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methoxy]phenyl]-4-phenylpyrrolidin-2-yl]acetate (PubChem CID 126689083) has the molecular formula C34H34FNO4 and a molecular weight of 539.65 g/mol. Its IUPAC name is methyl 2-[(2R,4S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methoxy]phenyl]-4-phenylpyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methoxy]phenyl]-4-phenylpyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 126689083 |
| Molecular Formula | C34H34FNO4 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | methyl 2-[(2R,4S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-2-methylphenyl]methoxy]phenyl]-4-phenylpyrrolidin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](c2ccccc2)CN1c1ccc(OCc2ccc(-c3cc(OC)ccc3F)cc2C)cc1 |
| InChI | InChI=1S/C34H34FNO4/c1-23-17-25(32-20-31(38-2)15-16-33(32)35)9-10-26(23)22-40-30-13-11-28(12-14-30)36-21-27(24-7-5-4-6-8-24)18-29(36)19-34(37)39-3/h4-17,20,27,29H,18-19,21-22H2,1-3H3/t27-,29-/m1/s1 |
| InChIKey | VXCZSMNEKBDCSC-XRKRLSELSA-N |
| XLogP | 7.31 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|