C20H22FNO3 — CID 58218710
2-[(2R,4S)-4-fluoro-1-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidin-2-yl]acetic acid (PubChem CID 58218710) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[(2R,4S)-4-fluoro-1-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,4S)-4-fluoro-1-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 58218710 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[(2R,4S)-4-fluoro-1-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidin-2-yl]acetic acid |
| SMILES | Cc1ccccc1COc1ccc(N2C[C@@H](F)C[C@H]2CC(=O)O)cc1 |
| InChI | InChI=1S/C20H22FNO3/c1-14-4-2-3-5-15(14)13-25-19-8-6-17(7-9-19)22-12-16(21)10-18(22)11-20(23)24/h2-9,16,18H,10-13H2,1H3,(H,23,24)/t16-,18-/m0/s1 |
| InChIKey | UTWLRJIJQVFNQY-WMZOPIPTSA-N |
| XLogP | 3.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|