C20H22F3NO2 — CID 67092852
[(2S,4S)-1-[4-[(2-methylphenyl)methoxy]phenyl]-4-(trifluoromethyl)pyrrolidin-2-yl]methanol (PubChem CID 67092852) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is [(2S,4S)-1-[4-[(2-methylphenyl)methoxy]phenyl]-4-(trifluoromethyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4S)-1-[4-[(2-methylphenyl)methoxy]phenyl]-4-(trifluoromethyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 67092852 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [(2S,4S)-1-[4-[(2-methylphenyl)methoxy]phenyl]-4-(trifluoromethyl)pyrrolidin-2-yl]methanol |
| SMILES | Cc1ccccc1COc1ccc(N2C[C@@H](C(F)(F)F)C[C@H]2CO)cc1 |
| InChI | InChI=1S/C20H22F3NO2/c1-14-4-2-3-5-15(14)13-26-19-8-6-17(7-9-19)24-11-16(20(21,22)23)10-18(24)12-25/h2-9,16,18,25H,10-13H2,1H3/t16-,18-/m0/s1 |
| InChIKey | FERZPPCWIBAQPO-WMZOPIPTSA-N |
| XLogP | 4.32 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|