C21H24FNO2 — CID 67092869
methyl 2-[(2R,4R)-4-fluoro-1-[4-[(2-methylphenyl)methyl]phenyl]pyrrolidin-2-yl]acetate (PubChem CID 67092869) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl 2-[(2R,4R)-4-fluoro-1-[4-[(2-methylphenyl)methyl]phenyl]pyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4R)-4-fluoro-1-[4-[(2-methylphenyl)methyl]phenyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 67092869 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | methyl 2-[(2R,4R)-4-fluoro-1-[4-[(2-methylphenyl)methyl]phenyl]pyrrolidin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H](F)CN1c1ccc(Cc2ccccc2C)cc1 |
| InChI | InChI=1S/C21H24FNO2/c1-15-5-3-4-6-17(15)11-16-7-9-19(10-8-16)23-14-18(22)12-20(23)13-21(24)25-2/h3-10,18,20H,11-14H2,1-2H3/t18-,20+/m1/s1 |
| InChIKey | QCCPWGNMMPFJAW-QUCCMNQESA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|