C28H30FNO4 — CID 90214617
methyl 2-[(2S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-3-methylphenyl]methoxy]phenyl]pyrrolidin-2-yl]acetate (PubChem CID 90214617) has the molecular formula C28H30FNO4 and a molecular weight of 463.55 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-3-methylphenyl]methoxy]phenyl]pyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-3-methylphenyl]methoxy]phenyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 90214617 |
| Molecular Formula | C28H30FNO4 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | methyl 2-[(2S)-1-[4-[[4-(2-fluoro-5-methoxyphenyl)-3-methylphenyl]methoxy]phenyl]pyrrolidin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CCCN1c1ccc(OCc2ccc(-c3cc(OC)ccc3F)c(C)c2)cc1 |
| InChI | InChI=1S/C28H30FNO4/c1-19-15-20(6-12-25(19)26-17-24(32-2)11-13-27(26)29)18-34-23-9-7-21(8-10-23)30-14-4-5-22(30)16-28(31)33-3/h6-13,15,17,22H,4-5,14,16,18H2,1-3H3/t22-/m0/s1 |
| InChIKey | LCFODTGVSLTKSO-QFIPXVFZSA-N |
| XLogP | 5.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|