About 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione
7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione (PubChem CID 118498697) has the molecular formula C16H12F2N2O3
and a molecular weight of 318.28 g/mol. Its IUPAC name is 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione |
| PubChem CID | 118498697 |
| Molecular Formula | C16H12F2N2O3 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)[nH]c3c(F)c(F)ccc3c2=O)cc1 |
| InChI | InChI=1S/C16H12F2N2O3/c1-23-10-4-2-9(3-5-10)8-20-15(21)11-6-7-12(17)13(18)14(11)19-16(20)22/h2-7H,8H2,1H3,(H,19,22) |
| InChIKey | MJTJRMPNLKWJGN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione?
The IUPAC name of 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione (CID 118498697) is 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione.
What is the SMILES notation for 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione?
The canonical SMILES for 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione is COc1ccc(Cn2c(=O)[nH]c3c(F)c(F)ccc3c2=O)cc1.
What is the InChIKey of 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione?
The InChIKey is MJTJRMPNLKWJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O3/c1-23-10-4-2-9(3-5-10)8-20-15(21)11-6-7-12(17)13(18)14(11)19-16(20)22/h2-7H,8H2,1H3,(H,19,22).
What are the key properties of 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione?
7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione has a molecular weight of 318.28 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione is sourced from PubChem (CID 118498697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).