C24H28Cl2N2O5 — CID 118498783
6,8-bis(3-chloro-2-hydroxy-2-methylpropyl)-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione (PubChem CID 118498783) has the molecular formula C24H28Cl2N2O5 and a molecular weight of 495.40 g/mol. Its IUPAC name is 6,8-bis(3-chloro-2-hydroxy-2-methylpropyl)-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione.
| Compound Name | 6,8-bis(3-chloro-2-hydroxy-2-methylpropyl)-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 118498783 |
| Molecular Formula | C24H28Cl2N2O5 |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 6,8-bis(3-chloro-2-hydroxy-2-methylpropyl)-3-[(4-methoxyphenyl)methyl]-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)[nH]c3c(CC(C)(O)CCl)cc(CC(C)(O)CCl)cc3c2=O)cc1 |
| InChI | InChI=1S/C24H28Cl2N2O5/c1-23(31,13-25)10-16-8-17(11-24(2,32)14-26)20-19(9-16)21(29)28(22(30)27-20)12-15-4-6-18(33-3)7-5-15/h4-9,31-32H,10-14H2,1-3H3,(H,27,30) |
| InChIKey | WBBJATIGDXKQPP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|