C17H15BrN2O3 — CID 176864839
8-bromo-3-[(4-methoxyphenyl)methyl]-6-methyl-1H-quinazoline-2,4-dione (PubChem CID 176864839) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is 8-bromo-3-[(4-methoxyphenyl)methyl]-6-methyl-1H-quinazoline-2,4-dione.
| Compound Name | 8-bromo-3-[(4-methoxyphenyl)methyl]-6-methyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 176864839 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 8-bromo-3-[(4-methoxyphenyl)methyl]-6-methyl-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)[nH]c3c(Br)cc(C)cc3c2=O)cc1 |
| InChI | InChI=1S/C17H15BrN2O3/c1-10-7-13-15(14(18)8-10)19-17(22)20(16(13)21)9-11-3-5-12(23-2)6-4-11/h3-8H,9H2,1-2H3,(H,19,22) |
| InChIKey | SFFQOHTVCSJPHL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |