C23H32N2O2 — CID 118501443
N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]pentanamide (PubChem CID 118501443) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]pentanamide.
| Compound Name | N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]pentanamide |
|---|---|
| PubChem CID | 118501443 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]pentanamide |
| SMILES | CCCCC(=O)N/N=C1\CCC2C3CCc4cc(O)ccc4C3CCC12C |
| InChI | InChI=1S/C23H32N2O2/c1-3-4-5-22(27)25-24-21-11-10-20-19-8-6-15-14-16(26)7-9-17(15)18(19)12-13-23(20,21)2/h7,9,14,18-20,26H,3-6,8,10-13H2,1-2H3,(H,25,27)/b24-21+ |
| InChIKey | YUZSNNYXCUSCSN-DARPEHSRSA-N |
| XLogP | 4.91 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|