C25H26N4O6 — CID 51667018
N-[(Z)-[(8S,9S,13R,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]-3,5-dinitrobenzamide (PubChem CID 51667018) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-[(Z)-[(8S,9S,13R,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]-3,5-dinitrobenzamide.
| Compound Name | N-[(Z)-[(8S,9S,13R,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 51667018 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-[(Z)-[(8S,9S,13R,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]amino]-3,5-dinitrobenzamide |
| SMILES | C[C@@]12CC[C@@H]3c4ccc(O)cc4CC[C@@H]3[C@@H]1CC/C2=N/NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N4O6/c1-25-9-8-20-19-5-3-18(30)12-14(19)2-4-21(20)22(25)6-7-23(25)26-27-24(31)15-10-16(28(32)33)13-17(11-15)29(34)35/h3,5,10-13,20-22,30H,2,4,6-9H2,1H3,(H,27,31)/b26-23-/t20-,21+,22+,25-/m1/s1 |
| InChIKey | WMVYBBWDFRHJPT-HKNJRGNXSA-N |
| XLogP | 4.85 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|