C28H39N3O4S — CID 130461699
N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]-6-[(2R)-2-hydroxy-5-oxo-3-sulfanylpyrrolidin-1-yl]hexanamide (PubChem CID 130461699) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]-6-[(2R)-2-hydroxy-5-oxo-3-sulfanylpyrrolidin-1-yl]hexanamide.
| Compound Name | N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]-6-[(2R)-2-hydroxy-5-oxo-3-sulfanylpyrrolidin-1-yl]hexanamide |
|---|---|
| PubChem CID | 130461699 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[(E)-(3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene)amino]-6-[(2R)-2-hydroxy-5-oxo-3-sulfanylpyrrolidin-1-yl]hexanamide |
| SMILES | CC12CCC3c4ccc(O)cc4CCC3C1CC/C2=N\NC(=O)CCCCCN1C(=O)CC(S)[C@H]1O |
| InChI | InChI=1S/C28H39N3O4S/c1-28-13-12-20-19-9-7-18(32)15-17(19)6-8-21(20)22(28)10-11-24(28)29-30-25(33)5-3-2-4-14-31-26(34)16-23(36)27(31)35/h7,9,15,20-23,27,32,35-36H,2-6,8,10-14,16H2,1H3,(H,30,33)/b29-24+/t20?,21?,22?,23?,27-,28?/m1/s1 |
| InChIKey | OQTFJUAMJILCHO-SZZYXLFTSA-N |
| XLogP | 4.13 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|