C14H21ClN4O4 — CID 11850593
(4R,5R,8S,9S,10S)-9-[(5-amino-6-chloropyrimidin-4-yl)amino]-8-(hydroxymethyl)-6-oxaspiro[4.5]decane-4,10-diol (PubChem CID 11850593) has the molecular formula C14H21ClN4O4 and a molecular weight of 344.80 g/mol. Its IUPAC name is (4R,5R,8S,9S,10S)-9-[(5-amino-6-chloropyrimidin-4-yl)amino]-8-(hydroxymethyl)-6-oxaspiro[4.5]decane-4,10-diol.
| Compound Name | (4R,5R,8S,9S,10S)-9-[(5-amino-6-chloropyrimidin-4-yl)amino]-8-(hydroxymethyl)-6-oxaspiro[4.5]decane-4,10-diol |
|---|---|
| PubChem CID | 11850593 |
| Molecular Formula | C14H21ClN4O4 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4R,5R,8S,9S,10S)-9-[(5-amino-6-chloropyrimidin-4-yl)amino]-8-(hydroxymethyl)-6-oxaspiro[4.5]decane-4,10-diol |
| SMILES | Nc1c(Cl)ncnc1N[C@H]1[C@@H](CO)CO[C@@]2(CCC[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C14H21ClN4O4/c15-12-9(16)13(18-6-17-12)19-10-7(4-20)5-23-14(11(10)22)3-1-2-8(14)21/h6-8,10-11,20-22H,1-5,16H2,(H,17,18,19)/t7-,8+,10-,11-,14+/m0/s1 |
| InChIKey | WWWKBMZQALLKSB-NEXPTJEISA-N |
| XLogP | -0.22 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |