C15H29ClN4O3 — CID 144952554
[(1R)-3-[(5-amino-6-chloropyrimidin-4-yl)amino]cyclopentyl]methanol;ethane;propane-2,2-diol (PubChem CID 144952554) has the molecular formula C15H29ClN4O3 and a molecular weight of 348.88 g/mol. Its IUPAC name is [(1R)-3-[(5-amino-6-chloropyrimidin-4-yl)amino]cyclopentyl]methanol;ethane;propane-2,2-diol.
| Compound Name | [(1R)-3-[(5-amino-6-chloropyrimidin-4-yl)amino]cyclopentyl]methanol;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 144952554 |
| Molecular Formula | C15H29ClN4O3 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1R)-3-[(5-amino-6-chloropyrimidin-4-yl)amino]cyclopentyl]methanol;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.Nc1c(Cl)ncnc1NC1CC[C@@H](CO)C1 |
| InChI | InChI=1S/C10H15ClN4O.C3H8O2.C2H6/c11-9-8(12)10(14-5-13-9)15-7-2-1-6(3-7)4-16;1-3(2,4)5;1-2/h5-7,16H,1-4,12H2,(H,13,14,15);4-5H,1-2H3;1-2H3/t6-,7?;;/m1../s1 |
| InChIKey | BTJLLKSMVBQKDS-DKPBNVODSA-N |
| XLogP | 2.02 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|