C18H18Cl2N4O — CID 143946912
[3-[[2-amino-6-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 143946912) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is [3-[[2-amino-6-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [3-[[2-amino-6-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 143946912 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [3-[[2-amino-6-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Nc1nc(Cl)c(C#Cc2ccccc2Cl)c(NC2CCC(CO)C2)n1 |
| InChI | InChI=1S/C18H18Cl2N4O/c19-15-4-2-1-3-12(15)6-8-14-16(20)23-18(21)24-17(14)22-13-7-5-11(9-13)10-25/h1-4,11,13,25H,5,7,9-10H2,(H3,21,22,23,24) |
| InChIKey | RVBYEINLKVYTFJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|