C17H18ClN5O — CID 88566282
[(1R,3S)-3-[[2-amino-6-chloro-5-(2-pyridin-3-ylethynyl)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 88566282) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is [(1R,3S)-3-[[2-amino-6-chloro-5-(2-pyridin-3-ylethynyl)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-[[2-amino-6-chloro-5-(2-pyridin-3-ylethynyl)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 88566282 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [(1R,3S)-3-[[2-amino-6-chloro-5-(2-pyridin-3-ylethynyl)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Nc1nc(Cl)c(C#Cc2cccnc2)c(N[C@H]2CC[C@@H](CO)C2)n1 |
| InChI | InChI=1S/C17H18ClN5O/c18-15-14(6-4-11-2-1-7-20-9-11)16(23-17(19)22-15)21-13-5-3-12(8-13)10-24/h1-2,7,9,12-13,24H,3,5,8,10H2,(H3,19,21,22,23)/t12-,13+/m1/s1 |
| InChIKey | YGHDSCQDDBXGON-OLZOCXBDSA-N |
| XLogP | 2.08 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|