C19H21ClN4O2 — CID 143946879
[(1R)-3-[[2-amino-6-chloro-5-[2-(4-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 143946879) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is [(1R)-3-[[2-amino-6-chloro-5-[2-(4-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R)-3-[[2-amino-6-chloro-5-[2-(4-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 143946879 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [(1R)-3-[[2-amino-6-chloro-5-[2-(4-methoxyphenyl)ethynyl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | COc1ccc(C#Cc2c(Cl)nc(N)nc2NC2CC[C@@H](CO)C2)cc1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-26-15-7-3-12(4-8-15)5-9-16-17(20)23-19(21)24-18(16)22-14-6-2-13(10-14)11-25/h3-4,7-8,13-14,25H,2,6,10-11H2,1H3,(H3,21,22,23,24)/t13-,14?/m1/s1 |
| InChIKey | CYYZYINGMSVIDW-KWCCSABGSA-N |
| XLogP | 2.69 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|